Products 620964-45-6
CAS 620964-45-6 is the registry number for (2R)-2-[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanamido]propanoic acid, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 5g.
(2R)-2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]propanoic acid (CAS 620964-45-6) is a chemical compound with the molecular formula C21H22N2O5 and a molecular weight of 382.4 g/mol. IUPAC name: (2R)-2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]propanoic acid. InChIKey: VXGGBPQPMISJCA-CHWSQXEVSA-N.
| Molecular formula | C21H22N2O5 |
|---|---|
| Molecular weight | 382.4 g/mol |
| IUPAC name | (2R)-2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]propanoic acid |
| InChIKey | VXGGBPQPMISJCA-CHWSQXEVSA-N |
| SMILES | C[C@H](C(=O)N[C@H](C)C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)