CAS 141990-91-2 is the registry number for N-(3-Cyanophenyl)benzamide, 95%. Offered by: AmBeed. Available pack sizes: 100mg.
N-(3-cyanophenyl)benzamide (CAS 141990-91-2) is a chemical compound with the molecular formula C14H10N2O and a molecular weight of 222.24 g/mol. IUPAC name: N-(3-cyanophenyl)benzamide. InChIKey: UCPDMPHZMMJOJJ-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | N-(3-cyanophenyl)benzamide |
| InChIKey | UCPDMPHZMMJOJJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=CC=CC(=C2)C#N |
Computed by PubChem (NCBI)