CAS 1421336-32-4 is the registry number for 5-Fluoro-1-(2',3'-dideoxy-2',3'-didehydro-5'-O-acetyl-b-L-ribofuranosyl)-uracil. Offered by: Biosynth. Available pack sizes: 1g.
[(2R,5S)-5-(2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methyl acetate (CAS 1421336-32-4) is a chemical compound with the molecular formula C11H12N2O5 and a molecular weight of 252.22 g/mol. IUPAC name: [(2R,5S)-5-(2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methyl acetate. InChIKey: ZJEYZGAQPYLRFC-SCZZXKLOSA-N.
| Molecular formula | C11H12N2O5 |
|---|---|
| Molecular weight | 252.22 g/mol |
| IUPAC name | [(2R,5S)-5-(2,4-dioxopyrimidin-1-yl)-2,5-dihydrofuran-2-yl]methyl acetate |
| InChIKey | ZJEYZGAQPYLRFC-SCZZXKLOSA-N |
| SMILES | CC(=O)OC[C@H]1C=C[C@H](O1)N2C=CC(=O)NC2=O |
Computed by PubChem (NCBI)