CAS 1421602-78-9 appears in our catalog under these names: 4-Amino-1-(trifluoromethyl)cyclohexan-1-ol hydrochloride, 95%, 4-Amino-1-(trifluoromethyl)cyclohexanol Hydrochloride, 4-Amino-1-(trifluoromethyl)cyclohexanol hydrochloride, 97%, 4-amino-1-(trifluoromethyl)cyclohexan-1-ol hydrochloride, 97%, 97%, 4-AMINO-1-(TRIFLUOROMETHYL)CYCLOHEXAN-1-OL HCL, 97%. Offered by: Combi-blocks, TRC, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 10g, 100mg, 500mg.
4-amino-1-(trifluoromethyl)cyclohexan-1-ol;hydrochloride (CAS 1421602-78-9) is a chemical compound with the molecular formula C7H13ClF3NO and a molecular weight of 219.63 g/mol. IUPAC name: 4-amino-1-(trifluoromethyl)cyclohexan-1-ol;hydrochloride. InChIKey: HYHNUWFMAWKRDR-UHFFFAOYSA-N.
| Molecular formula | C7H13ClF3NO |
|---|---|
| Molecular weight | 219.63 g/mol |
| IUPAC name | 4-amino-1-(trifluoromethyl)cyclohexan-1-ol;hydrochloride |
| InChIKey | HYHNUWFMAWKRDR-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1N)(C(F)(F)F)O.Cl |
Computed by PubChem (NCBI)