Products 1638764-95-0
CAS 1638764-95-0 appears in our catalog under these names: 4-(Trifluoromethyl)azepan-4-ol hydrochloride, 95%, 4-(Trifluoromethyl)azepan-4-ol hydrochloride, 98+%, -4(Trifluoromethyl)Azepan-4-Ol Hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100mg, 250mg, 1g, 5g, 0,5g, 50mg.
4-(trifluoromethyl)azepan-4-ol;hydrochloride (CAS 1638764-95-0) is a chemical compound with the molecular formula C7H13ClF3NO and a molecular weight of 219.63 g/mol. IUPAC name: 4-(trifluoromethyl)azepan-4-ol;hydrochloride. InChIKey: LQZVRWLXSOJGBA-UHFFFAOYSA-N.
| Molecular formula | C7H13ClF3NO |
|---|---|
| Molecular weight | 219.63 g/mol |
| IUPAC name | 4-(trifluoromethyl)azepan-4-ol;hydrochloride |
| InChIKey | LQZVRWLXSOJGBA-UHFFFAOYSA-N |
| SMILES | C1CC(CCNC1)(C(F)(F)F)O.Cl |
Computed by PubChem (NCBI)