CAS 2137056-98-3 appears in our catalog under these names: (1S,4s)-4-amino-1-(trifluoromethyl)cyclohexan-1-ol hydrochloride, 97%, rac-(1R,4R)-4-Amino-1-(trifluoromethyl)cyclohexan-1-ol hydrochloride, trans-4-Amino-1-(trifluoromethyl)cyclohexan-1-ol hydrochloride, 97%, 97%, rac-(1r,4r)-4-amino-1-(trifluoromethyl)cyclohexan-1-ol hydrochloride, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 100mg, 250mg, 500mg.
4-amino-1-(trifluoromethyl)cyclohexan-1-ol;hydrochloride (CAS 2137056-98-3) is a chemical compound with the molecular formula C7H13ClF3NO and a molecular weight of 219.63 g/mol. IUPAC name: 4-amino-1-(trifluoromethyl)cyclohexan-1-ol;hydrochloride. InChIKey: HYHNUWFMAWKRDR-UHFFFAOYSA-N.
| Molecular formula | C7H13ClF3NO |
|---|---|
| Molecular weight | 219.63 g/mol |
| IUPAC name | 4-amino-1-(trifluoromethyl)cyclohexan-1-ol;hydrochloride |
| InChIKey | HYHNUWFMAWKRDR-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1N)(C(F)(F)F)O.Cl |
Computed by PubChem (NCBI)