CAS 2376143-25-6 appears in our catalog under these names: 3-(Trifluoromethoxy)cyclohexan-1-amine hydrochloride, 98%, 3-Trifluoromethoxy-cyclohexylamine hydrochloride. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 50mg, 0,5g.
3-(trifluoromethoxy)cyclohexan-1-amine;hydrochloride (CAS 2376143-25-6) is a chemical compound with the molecular formula C7H13ClF3NO and a molecular weight of 219.63 g/mol. IUPAC name: 3-(trifluoromethoxy)cyclohexan-1-amine;hydrochloride. InChIKey: SXTXWRXLISYCJE-UHFFFAOYSA-N.
| Molecular formula | C7H13ClF3NO |
|---|---|
| Molecular weight | 219.63 g/mol |
| IUPAC name | 3-(trifluoromethoxy)cyclohexan-1-amine;hydrochloride |
| InChIKey | SXTXWRXLISYCJE-UHFFFAOYSA-N |
| SMILES | C1CC(CC(C1)OC(F)(F)F)N.Cl |
Computed by PubChem (NCBI)