Products 1823871-46-0
CAS 1823871-46-0 is the registry number for 3-(Trifluoromethyl)azepan-3-ol hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g.
3-(trifluoromethyl)azepan-3-ol;hydrochloride (CAS 1823871-46-0) is a chemical compound with the molecular formula C7H13ClF3NO and a molecular weight of 219.63 g/mol. IUPAC name: 3-(trifluoromethyl)azepan-3-ol;hydrochloride. InChIKey: DFKJATRNVXNYSM-UHFFFAOYSA-N.
| Molecular formula | C7H13ClF3NO |
|---|---|
| Molecular weight | 219.63 g/mol |
| IUPAC name | 3-(trifluoromethyl)azepan-3-ol;hydrochloride |
| InChIKey | DFKJATRNVXNYSM-UHFFFAOYSA-N |
| SMILES | C1CCNCC(C1)(C(F)(F)F)O.Cl |
Computed by PubChem (NCBI)