Products 2377009-56-6
CAS 2377009-56-6 is the registry number for 3-((1,1,1-Trifluoro-2-methylpropan-2-yl)oxy)azetidine hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(1,1,1-trifluoro-2-methylpropan-2-yl)oxyazetidine;hydrochloride (CAS 2377009-56-6) is a chemical compound with the molecular formula C7H13ClF3NO and a molecular weight of 219.63 g/mol. IUPAC name: 3-(1,1,1-trifluoro-2-methylpropan-2-yl)oxyazetidine;hydrochloride. InChIKey: ISYCEQVTDCGCRB-UHFFFAOYSA-N.
| Molecular formula | C7H13ClF3NO |
|---|---|
| Molecular weight | 219.63 g/mol |
| IUPAC name | 3-(1,1,1-trifluoro-2-methylpropan-2-yl)oxyazetidine;hydrochloride |
| InChIKey | ISYCEQVTDCGCRB-UHFFFAOYSA-N |
| SMILES | CC(C)(C(F)(F)F)OC1CNC1.Cl |
Computed by PubChem (NCBI)