Products 1423024-51-4
CAS 1423024-51-4 is the registry number for 2-(2,6-Difluorophenyl)-2-(dimethylamino)acetic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(2,6-difluorophenyl)-2-(dimethylamino)acetic acid;hydrochloride (CAS 1423024-51-4) is a chemical compound with the molecular formula C10H12ClF2NO2 and a molecular weight of 251.66 g/mol. IUPAC name: 2-(2,6-difluorophenyl)-2-(dimethylamino)acetic acid;hydrochloride. InChIKey: GEMSEDUCAACKKZ-UHFFFAOYSA-N.
| Molecular formula | C10H12ClF2NO2 |
|---|---|
| Molecular weight | 251.66 g/mol |
| IUPAC name | 2-(2,6-difluorophenyl)-2-(dimethylamino)acetic acid;hydrochloride |
| InChIKey | GEMSEDUCAACKKZ-UHFFFAOYSA-N |
| SMILES | CN(C)C(C1=C(C=CC=C1F)F)C(=O)O.Cl |
Computed by PubChem (NCBI)