CAS 1423025-74-4 appears in our catalog under these names: 3-(3,5-Dimethyl-1H-pyrazol-4-yl)butanoic acid, 95%, 3-(3,5-Dimethyl-1H-pyrazol-4-yl)butanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
3-(3,5-dimethyl-1H-pyrazol-4-yl)butanoic acid (CAS 1423025-74-4) is a chemical compound with the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. IUPAC name: 3-(3,5-dimethyl-1H-pyrazol-4-yl)butanoic acid. InChIKey: LIQQUKTZYMHVQM-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O2 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 3-(3,5-dimethyl-1H-pyrazol-4-yl)butanoic acid |
| InChIKey | LIQQUKTZYMHVQM-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C)C(C)CC(=O)O |
Computed by PubChem (NCBI)