CAS 1423029-71-3 appears in our catalog under these names: 2-{4-((2-cyanopyridin-4-yl)oxy)phenyl}acetic acid, 95%, 2-{4-((2-Cyanopyridin-4-yl)oxy)phenyl}acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-[4-[(2-cyano-4-pyridinyl)oxy]phenyl]acetic acid (CAS 1423029-71-3) is a chemical compound with the molecular formula C14H10N2O3 and a molecular weight of 254.24 g/mol. IUPAC name: 2-[4-[(2-cyano-4-pyridinyl)oxy]phenyl]acetic acid. InChIKey: QFEYWPXBMRNHBI-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O3 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 2-[4-[(2-cyano-4-pyridinyl)oxy]phenyl]acetic acid |
| InChIKey | QFEYWPXBMRNHBI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)O)OC2=CC(=NC=C2)C#N |
Computed by PubChem (NCBI)