CAS 1423029-80-4 appears in our catalog under these names: 6–Isopropylnicotinic acid hydrochloride, 6-(Propan-2-yl)pyridine-3-carboxylic acid hydrochloride, 6-Isopropylnicotinic acid hydrochloride, 98%, 98%, 6-Isopropylnicotinic acid hydrochloride, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 2,5g, 1g, 5g.
6-propan-2-ylpyridine-3-carboxylic acid;hydrochloride (CAS 1423029-80-4) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: 6-propan-2-ylpyridine-3-carboxylic acid;hydrochloride. InChIKey: KCTAJFRERGSOOT-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | 6-propan-2-ylpyridine-3-carboxylic acid;hydrochloride |
| InChIKey | KCTAJFRERGSOOT-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC=C(C=C1)C(=O)O.Cl |
Computed by PubChem (NCBI)