CAS 1423034-34-7 appears in our catalog under these names: Methyl 2-(4-acetyl-1H-1,2,3-triazol-1-yl)acetate, 95%, Methyl 2-(4-acetyl-1H-1,2,3-triazol-1-yl)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Methyl 2-(4-acetyltriazol-1-yl)acetate (CAS 1423034-34-7) is a chemical compound with the molecular formula C7H9N3O3 and a molecular weight of 183.16 g/mol. IUPAC name: methyl 2-(4-acetyltriazol-1-yl)acetate. InChIKey: AWCSVOIKRWXZKM-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O3 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | methyl 2-(4-acetyltriazol-1-yl)acetate |
| InChIKey | AWCSVOIKRWXZKM-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CN(N=N1)CC(=O)OC |
Computed by PubChem (NCBI)