Products 1423037-14-2
CAS 1423037-14-2 is the registry number for (2E)-3-(1-Ethyl-1H-imidazol-2-yl)prop-2-enoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(E)-3-(1-ethylimidazol-2-yl)prop-2-enoic acid;hydrochloride (CAS 1423037-14-2) is a chemical compound with the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. IUPAC name: (E)-3-(1-ethylimidazol-2-yl)prop-2-enoic acid;hydrochloride. InChIKey: YXQAGLKGTIRJIE-BJILWQEISA-N.
| Molecular formula | C8H11ClN2O2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | (E)-3-(1-ethylimidazol-2-yl)prop-2-enoic acid;hydrochloride |
| InChIKey | YXQAGLKGTIRJIE-BJILWQEISA-N |
| SMILES | CCN1C=CN=C1/C=C/C(=O)O.Cl |
Computed by PubChem (NCBI)