Products 1427326-66-6

CAS 1427326-66-6 is the registry number for 2-Bromo-3-fluoro-6-methylbenzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-bromo-3-fluoro-6-methylbenzoic acid (CAS 1427326-66-6) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 2-bromo-3-fluoro-6-methylbenzoic acid. InChIKey: QWXYFCBTEVCONQ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6BrFO2
Molecular weight233.03 g/mol
IUPAC name2-bromo-3-fluoro-6-methylbenzoic acid
InChIKeyQWXYFCBTEVCONQ-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C=C1)F)Br)C(=O)O

Computed by PubChem (NCBI)