Products 1427326-66-6
CAS 1427326-66-6 appears in our catalog under these names: 2-Bromo-3-fluoro-6-methylbenzoic acid, 2-Bromo-3-fluoro-6-methylbenzoic Acid, >95%. Offered by: Biosynth, Chemat. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g.
2-bromo-3-fluoro-6-methylbenzoic acid (CAS 1427326-66-6) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 2-bromo-3-fluoro-6-methylbenzoic acid. InChIKey: QWXYFCBTEVCONQ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 2-bromo-3-fluoro-6-methylbenzoic acid |
| InChIKey | QWXYFCBTEVCONQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)F)Br)C(=O)O |
Computed by PubChem (NCBI)