CAS 1427356-93-1 is the registry number for 5-Bromo-6-methoxyisoindolin-1-one, 98%. Offered by: AmBeed. Available pack sizes: 1g.
5-bromo-6-methoxy-2,3-dihydroisoindol-1-one (CAS 1427356-93-1) is a chemical compound with the molecular formula C9H8BrNO2 and a molecular weight of 242.07 g/mol. IUPAC name: 5-bromo-6-methoxy-2,3-dihydroisoindol-1-one. InChIKey: XEHWYIJFOSJKLE-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO2 |
|---|---|
| Molecular weight | 242.07 g/mol |
| IUPAC name | 5-bromo-6-methoxy-2,3-dihydroisoindol-1-one |
| InChIKey | XEHWYIJFOSJKLE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2CNC(=O)C2=C1)Br |
Computed by PubChem (NCBI)