CAS 1427360-45-9 appears in our catalog under these names: 6-Bromo-5-methoxy-2,3-dihydro-isoindol-1-one, 96%, 6-Bromo-5-methoxy-2,3-dihydro-isoindol-1-one, 6-Bromo-5-methoxy-2,3-dihydro-isoindol-1-one, 95%, 95%, 6-Bromo-5-methoxyisoindolin-1-one, 95%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 50mg, 0,5g.
6-bromo-5-methoxy-2,3-dihydroisoindol-1-one (CAS 1427360-45-9) is a chemical compound with the molecular formula C9H8BrNO2 and a molecular weight of 242.07 g/mol. IUPAC name: 6-bromo-5-methoxy-2,3-dihydroisoindol-1-one. InChIKey: XQCYRBWOLQWKDK-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO2 |
|---|---|
| Molecular weight | 242.07 g/mol |
| IUPAC name | 6-bromo-5-methoxy-2,3-dihydroisoindol-1-one |
| InChIKey | XQCYRBWOLQWKDK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)CNC2=O)Br |
Computed by PubChem (NCBI)