CAS 1427365-67-0 appears in our catalog under these names: 4–Chloro–5–fluoro–2–methylbenzoic acid, 4-Chloro-5-fluoro-2-methylbenzoic acid 95%, 4-Chloro-5-fluoro-2-methylbenzoic acid, 95%, 95%, 4-CHLORO-5-FLUORO-2-METHYLBENZOIC ACID, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-chloro-5-fluoro-2-methylbenzoic acid (CAS 1427365-67-0) is a chemical compound with the molecular formula C8H6ClFO2 and a molecular weight of 188.58 g/mol. IUPAC name: 4-chloro-5-fluoro-2-methylbenzoic acid. InChIKey: DLZFKMYILRWTHU-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO2 |
|---|---|
| Molecular weight | 188.58 g/mol |
| IUPAC name | 4-chloro-5-fluoro-2-methylbenzoic acid |
| InChIKey | DLZFKMYILRWTHU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(=O)O)F)Cl |
Computed by PubChem (NCBI)