Products 1427373-55-4
CAS 1427373-55-4 appears in our catalog under these names: 3-Bromo-6-fluoro-2-methyl-benzoic acid, 95%, 3-Bromo-6-fluoro-2-methylbenzoic Acid, 3–Bromo–6–fluoro–2–methylbenzoic acid, 3-Bromo-6-fluoro-2-methylbenzoic acid 98%, 3-bromo-6-fluoro-2-methyl-benzoic acid, 98%, 98%. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g, 2,5g, 10g, 25g.
3-bromo-6-fluoro-2-methylbenzoic acid (CAS 1427373-55-4) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 3-bromo-6-fluoro-2-methylbenzoic acid. InChIKey: DHAJISDATRWQGB-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 3-bromo-6-fluoro-2-methylbenzoic acid |
| InChIKey | DHAJISDATRWQGB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1C(=O)O)F)Br |
Computed by PubChem (NCBI)