Products 1427383-34-3
CAS 1427383-34-3 is the registry number for 5-Bromo-6-chloroisoindolin-1-one, 95%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 50mg, 100mg.
5-bromo-6-chloro-2,3-dihydroisoindol-1-one (CAS 1427383-34-3) is a chemical compound with the molecular formula C8H5BrClNO and a molecular weight of 246.49 g/mol. IUPAC name: 5-bromo-6-chloro-2,3-dihydroisoindol-1-one. InChIKey: RRFYSZZAGXOFIF-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClNO |
|---|---|
| Molecular weight | 246.49 g/mol |
| IUPAC name | 5-bromo-6-chloro-2,3-dihydroisoindol-1-one |
| InChIKey | RRFYSZZAGXOFIF-UHFFFAOYSA-N |
| SMILES | C1C2=CC(=C(C=C2C(=O)N1)Cl)Br |
Computed by PubChem (NCBI)