CAS 1427391-98-7 appears in our catalog under these names: 2-Chloro-4-fluoro-6-methylbenzoic acid, 98%, 2-Chloro-4-fluoro-6-methylbenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-chloro-4-fluoro-6-methylbenzoic acid (CAS 1427391-98-7) is a chemical compound with the molecular formula C8H6ClFO2 and a molecular weight of 188.58 g/mol. IUPAC name: 2-chloro-4-fluoro-6-methylbenzoic acid. InChIKey: YWBKKVASGGLEDV-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO2 |
|---|---|
| Molecular weight | 188.58 g/mol |
| IUPAC name | 2-chloro-4-fluoro-6-methylbenzoic acid |
| InChIKey | YWBKKVASGGLEDV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C(=O)O)Cl)F |
Computed by PubChem (NCBI)