CAS 1427416-60-1 is the registry number for 6-Bromo-4-chloroisoindolin-1-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 25g, 50g, 100g, 100mg, 250mg, 1g, 5g, 10g.
6-bromo-4-chloro-2,3-dihydroisoindol-1-one (CAS 1427416-60-1) is a chemical compound with the molecular formula C8H5BrClNO and a molecular weight of 246.49 g/mol. IUPAC name: 6-bromo-4-chloro-2,3-dihydroisoindol-1-one. InChIKey: PJQKKVVUZQKOMR-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClNO |
|---|---|
| Molecular weight | 246.49 g/mol |
| IUPAC name | 6-bromo-4-chloro-2,3-dihydroisoindol-1-one |
| InChIKey | PJQKKVVUZQKOMR-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2Cl)Br)C(=O)N1 |
Computed by PubChem (NCBI)