CAS 1427418-68-5 is the registry number for 4-Chloro-3-fluoro-5-methylbenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-chloro-3-fluoro-5-methylbenzoic acid (CAS 1427418-68-5) is a chemical compound with the molecular formula C8H6ClFO2 and a molecular weight of 188.58 g/mol. IUPAC name: 4-chloro-3-fluoro-5-methylbenzoic acid. InChIKey: CXFKHPXKJDIYHW-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO2 |
|---|---|
| Molecular weight | 188.58 g/mol |
| IUPAC name | 4-chloro-3-fluoro-5-methylbenzoic acid |
| InChIKey | CXFKHPXKJDIYHW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Cl)F)C(=O)O |
Computed by PubChem (NCBI)