Products 1427433-22-4
CAS 1427433-22-4 appears in our catalog under these names: 3-bromo-2-fluoro-6-methylbenzoic acid, 95%, 3–Bromo–2–fluoro–6–methyl–benzoic acid, 3-Bromo-2-fluoro-6-methylbenzoic acid, 3-Bromo-2-fluoro-6-methyl-benzoic acid 95%, 3-bromo-2-fluoro-6-methylbenzoic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg, 5g.
3-bromo-2-fluoro-6-methylbenzoic acid (CAS 1427433-22-4) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 3-bromo-2-fluoro-6-methylbenzoic acid. InChIKey: UWEYXKANOPMPLE-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 3-bromo-2-fluoro-6-methylbenzoic acid |
| InChIKey | UWEYXKANOPMPLE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)Br)F)C(=O)O |
Computed by PubChem (NCBI)