CAS 1427433-28-0 appears in our catalog under these names: 5-Bromo-3-fluoro-2-methylbenzoic acid, 95%, 5–Bromo–3–fluoro–2–methylbenzoic acid, 5-Bromo-3-fluoro-2-methylbenzoic acid, 95%, 95%, 5-BROMO-3-FLUORO-2-METHYLBENZOIC ACID, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g.
5-bromo-3-fluoro-2-methylbenzoic acid (CAS 1427433-28-0) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 5-bromo-3-fluoro-2-methylbenzoic acid. InChIKey: NIAUVDRUTMQEBK-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 5-bromo-3-fluoro-2-methylbenzoic acid |
| InChIKey | NIAUVDRUTMQEBK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1F)Br)C(=O)O |
Computed by PubChem (NCBI)