Products 142793-24-6
CAS 142793-24-6 appears in our catalog under these names: (1S,2S)-2-(4-Chlorophenyl)cyclopropanecarboxylic Acid, 95%, 95%, (1S,2S)-2-(4-CHLOROPHENYL)CYCLOPROPANE-1-CARBOXYLIC ACID, 95%, (1S,2S)-2-(4-Chlorophenyl)cyclopropanecarboxylic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
Trans-(1S,2S)-2-(4-chlorophenyl)cyclopropane-1-carboxylic acid (CAS 142793-24-6) is a chemical compound with the molecular formula C10H9ClO2 and a molecular weight of 196.63 g/mol. IUPAC name: trans-(1S,2S)-2-(4-chlorophenyl)cyclopropane-1-carboxylic acid. InChIKey: JZYXJKBNUJJIKU-BDAKNGLRSA-N.
| Molecular formula | C10H9ClO2 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | trans-(1S,2S)-2-(4-chlorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | JZYXJKBNUJJIKU-BDAKNGLRSA-N |
| SMILES | C1[C@@H]([C@H]1C(=O)O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)