Products 31501-86-7

CAS 31501-86-7 is the registry number for (1R,2R)-2-(4-Chlorophenyl)cyclopropanecarboxylic Acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Trans-(1R,2R)-2-(4-chlorophenyl)cyclopropane-1-carboxylic acid (CAS 31501-86-7) is a chemical compound with the molecular formula C10H9ClO2 and a molecular weight of 196.63 g/mol. IUPAC name: trans-(1R,2R)-2-(4-chlorophenyl)cyclopropane-1-carboxylic acid. InChIKey: JZYXJKBNUJJIKU-DTWKUNHWSA-N.

Identity
Molecular formulaC10H9ClO2
Molecular weight196.63 g/mol
IUPAC nametrans-(1R,2R)-2-(4-chlorophenyl)cyclopropane-1-carboxylic acid
InChIKeyJZYXJKBNUJJIKU-DTWKUNHWSA-N
SMILESC1[C@H]([C@@H]1C(=O)O)C2=CC=C(C=C2)Cl

Computed by PubChem (NCBI)