Products 142796-15-4
CAS 142796-15-4 is the registry number for Cyclopropanecarboxylic acid, 2-(4-chlorophenyl)-, cis-, >97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Cis-(1R,2S)-2-(4-chlorophenyl)cyclopropane-1-carboxylic acid (CAS 142796-15-4) is a chemical compound with the molecular formula C10H9ClO2 and a molecular weight of 196.63 g/mol. IUPAC name: cis-(1R,2S)-2-(4-chlorophenyl)cyclopropane-1-carboxylic acid. InChIKey: JZYXJKBNUJJIKU-RKDXNWHRSA-N.
| Molecular formula | C10H9ClO2 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | cis-(1R,2S)-2-(4-chlorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | JZYXJKBNUJJIKU-RKDXNWHRSA-N |
| SMILES | C1[C@@H]([C@@H]1C(=O)O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)