CAS 1428243-24-6 appears in our catalog under these names: Upadacitinib Impurity 1, Upadacitinib Impurity 2, (3R,4S)-1-((Benzyloxy)carbonyl)-4-ethylpyrrolidine-3-carboxylic acid 97%, (3R,4S)-1-((Benzyloxy)carbonyl)-4-ethylpyrrolidine-3-carboxylic acid, 97%, 97%. Offered by: Chemat Brand, Hubei YoungXin, Ambeed, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 1g.
(3R,4S)-4-ethyl-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid (CAS 1428243-24-6) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: (3R,4S)-4-ethyl-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid. InChIKey: LKPALAXKZXXURJ-OLZOCXBDSA-N.
| Molecular formula | C15H19NO4 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | (3R,4S)-4-ethyl-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid |
| InChIKey | LKPALAXKZXXURJ-OLZOCXBDSA-N |
| SMILES | CC[C@@H]1CN(C[C@@H]1C(=O)O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)