CAS 1428243-69-9 appears in our catalog under these names: Upadacitinib Impurity 21, (3S,4R)-1-((Benzyloxy)carbonyl)-4-ethylpyrrolidine-3-carboxylic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 750mg.
(3S,4R)-4-ethyl-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid (CAS 1428243-69-9) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: (3S,4R)-4-ethyl-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid. InChIKey: LKPALAXKZXXURJ-QWHCGFSZSA-N.
| Molecular formula | C15H19NO4 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | (3S,4R)-4-ethyl-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid |
| InChIKey | LKPALAXKZXXURJ-QWHCGFSZSA-N |
| SMILES | CC[C@H]1CN(C[C@H]1C(=O)O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)