Products 1708997-45-8

CAS 1708997-45-8 is the registry number for 1-((Benzyloxy)carbonyl)-4-ethylpyrrolidine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-ethyl-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid (CAS 1708997-45-8) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: 4-ethyl-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid. InChIKey: LKPALAXKZXXURJ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H19NO4
Molecular weight277.31 g/mol
IUPAC name4-ethyl-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid
InChIKeyLKPALAXKZXXURJ-UHFFFAOYSA-N
SMILESCCC1CN(CC1C(=O)O)C(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)