Products 142831-06-9
CAS 142831-06-9 is the registry number for 5-Hydroxy-7-(4-hydroxy-3-methoxyphenyl)-1-phenylhept-4-en-3-one. Offered by: MedChemExpress. Available pack sizes: Get quote.
(Z)-5-hydroxy-7-(4-hydroxy-3-methoxyphenyl)-1-phenylhept-4-en-3-one (CAS 142831-06-9) is a chemical compound with the molecular formula C20H22O4 and a molecular weight of 326.4 g/mol. IUPAC name: (Z)-5-hydroxy-7-(4-hydroxy-3-methoxyphenyl)-1-phenylhept-4-en-3-one. InChIKey: OVFDCBYFUJKJCF-JXAWBTAJSA-N.
| Molecular formula | C20H22O4 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | (Z)-5-hydroxy-7-(4-hydroxy-3-methoxyphenyl)-1-phenylhept-4-en-3-one |
| InChIKey | OVFDCBYFUJKJCF-JXAWBTAJSA-N |
| SMILES | COC1=C(C=CC(=C1)CC/C(=C/C(=O)CCC2=CC=CC=C2)/O)O |
Computed by PubChem (NCBI)