CAS 1428725-91-0 is the registry number for 5-Bromo-3-hydroxy-2,3-dihydrobenzothiophene 1,1-dioxide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
5-bromo-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-ol (CAS 1428725-91-0) is a chemical compound with the molecular formula C8H7BrO3S and a molecular weight of 263.11 g/mol. IUPAC name: 5-bromo-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-ol. InChIKey: AUOMRBNQWQRJBQ-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3S |
|---|---|
| Molecular weight | 263.11 g/mol |
| IUPAC name | 5-bromo-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-ol |
| InChIKey | AUOMRBNQWQRJBQ-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(S1(=O)=O)C=CC(=C2)Br)O |
Computed by PubChem (NCBI)