Products 96991-64-9
CAS 96991-64-9 is the registry number for Methyl 4-(2-bromoacetyl)thiophene-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 4-(2-bromoacetyl)thiophene-2-carboxylate (CAS 96991-64-9) is a chemical compound with the molecular formula C8H7BrO3S and a molecular weight of 263.11 g/mol. IUPAC name: methyl 4-(2-bromoacetyl)thiophene-2-carboxylate. InChIKey: JONVBZSBGOIKNB-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3S |
|---|---|
| Molecular weight | 263.11 g/mol |
| IUPAC name | methyl 4-(2-bromoacetyl)thiophene-2-carboxylate |
| InChIKey | JONVBZSBGOIKNB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CS1)C(=O)CBr |
Computed by PubChem (NCBI)