CAS 1778631-83-6 is the registry number for 6-Bromo-2,3-dihydrobenzo(b)(1,4)oxathiine 4,4-dioxide, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
6-bromo-2,3-dihydro-1,4lambda6-benzoxathiine 4,4-dioxide (CAS 1778631-83-6) is a chemical compound with the molecular formula C8H7BrO3S and a molecular weight of 263.11 g/mol. IUPAC name: 6-bromo-2,3-dihydro-1,4lambda6-benzoxathiine 4,4-dioxide. InChIKey: BLDXBFTVZOVDRV-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3S |
|---|---|
| Molecular weight | 263.11 g/mol |
| IUPAC name | 6-bromo-2,3-dihydro-1,4lambda6-benzoxathiine 4,4-dioxide |
| InChIKey | BLDXBFTVZOVDRV-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)C2=C(O1)C=CC(=C2)Br |
Computed by PubChem (NCBI)