CAS 2110781-56-9 is the registry number for 3-Thiophenecarboxylic acid, 2-bromo-5-formyl-, ethyl ester, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-bromo-5-formylthiophene-3-carboxylate (CAS 2110781-56-9) is a chemical compound with the molecular formula C8H7BrO3S and a molecular weight of 263.11 g/mol. IUPAC name: ethyl 2-bromo-5-formylthiophene-3-carboxylate. InChIKey: JRDAKPUCSNWOBO-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3S |
|---|---|
| Molecular weight | 263.11 g/mol |
| IUPAC name | ethyl 2-bromo-5-formylthiophene-3-carboxylate |
| InChIKey | JRDAKPUCSNWOBO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC(=C1)C=O)Br |
Computed by PubChem (NCBI)