Products 2110781-56-9

CAS 2110781-56-9 is the registry number for 3-Thiophenecarboxylic acid, 2-bromo-5-formyl-, ethyl ester, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 2-bromo-5-formylthiophene-3-carboxylate (CAS 2110781-56-9) is a chemical compound with the molecular formula C8H7BrO3S and a molecular weight of 263.11 g/mol. IUPAC name: ethyl 2-bromo-5-formylthiophene-3-carboxylate. InChIKey: JRDAKPUCSNWOBO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7BrO3S
Molecular weight263.11 g/mol
IUPAC nameethyl 2-bromo-5-formylthiophene-3-carboxylate
InChIKeyJRDAKPUCSNWOBO-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(SC(=C1)C=O)Br

Computed by PubChem (NCBI)