Products 704200-66-8

CAS 704200-66-8 is the registry number for Ethyl 2-(4-bromothiophen-3-yl)-2-oxoacetate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 2-(4-bromothiophen-3-yl)-2-oxoacetate (CAS 704200-66-8) is a chemical compound with the molecular formula C8H7BrO3S and a molecular weight of 263.11 g/mol. IUPAC name: ethyl 2-(4-bromothiophen-3-yl)-2-oxoacetate. InChIKey: TXOCYFXCASYKQH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7BrO3S
Molecular weight263.11 g/mol
IUPAC nameethyl 2-(4-bromothiophen-3-yl)-2-oxoacetate
InChIKeyTXOCYFXCASYKQH-UHFFFAOYSA-N
SMILESCCOC(=O)C(=O)C1=CSC=C1Br

Computed by PubChem (NCBI)