Products 52240-28-5
CAS 52240-28-5 is the registry number for 4-(5-Bromo-2-thienyl)-4-oxobutyric acid, 95%. Offered by: Fluorochem. Available pack sizes: 1g, 2.5g, 5g, 10g, 25g.
4-(5-bromothiophen-2-yl)-4-oxobutanoic acid (CAS 52240-28-5) is a chemical compound with the molecular formula C8H7BrO3S and a molecular weight of 263.11 g/mol. IUPAC name: 4-(5-bromothiophen-2-yl)-4-oxobutanoic acid. InChIKey: FOUVWVYUMOWJPZ-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3S |
|---|---|
| Molecular weight | 263.11 g/mol |
| IUPAC name | 4-(5-bromothiophen-2-yl)-4-oxobutanoic acid |
| InChIKey | FOUVWVYUMOWJPZ-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)Br)C(=O)CCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-(5-Bromo-2-thienyl)-4-oxobutyric acid, 4-(5-bromothiophen-2-yl)-4-oxobutanoic acid, 2-Thiophenebutanoic acid, 5-bromo-g-oxo-, FOUVWVYUMOWJPZ-UHFFFAOYSA-N, 4-(5-Bromo-2-thienyl)-4-oxobutyricacid, 4-(5-bromo-2-thienyl)-4-ketobutyric acid, 4-(5-bromo-2-thienyl)-4-oxobutanoic acid, 4-(5-bromo(2-thienyl))-4-oxobutanoic acid, 4-(5-bromo-2-thienyl)-4-oxo-butanoic acid