Products 142927-08-0
CAS 142927-08-0 appears in our catalog under these names: (S)-2-(4-Nitrophenyl)propionic acid, 98%, 98%, (S)-2-(4-Nitrophenyl)propanoic acid, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-(4-nitrophenyl)propanoic acid (CAS 142927-08-0) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: (2S)-2-(4-nitrophenyl)propanoic acid. InChIKey: RBSRRICSXWXMRC-LURJTMIESA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | (2S)-2-(4-nitrophenyl)propanoic acid |
| InChIKey | RBSRRICSXWXMRC-LURJTMIESA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)