CAS 1429617-95-7 is the registry number for Methyl 4-ethyl-3-ethynylbenzoate, 97%. Offered by: AmBeed. Available pack sizes: 5g.
Methyl 4-ethyl-3-ethynylbenzoate (CAS 1429617-95-7) is a chemical compound with the molecular formula C12H12O2 and a molecular weight of 188.22 g/mol. IUPAC name: methyl 4-ethyl-3-ethynylbenzoate. InChIKey: LNHNFZQDRNVYRM-UHFFFAOYSA-N.
| Molecular formula | C12H12O2 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | methyl 4-ethyl-3-ethynylbenzoate |
| InChIKey | LNHNFZQDRNVYRM-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=C(C=C1)C(=O)OC)C#C |
Computed by PubChem (NCBI)