Products 1431364-32-7
CAS 1431364-32-7 is the registry number for Cis-tert-butyl 3-(4-nitrophenyl)aziridine-2-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
Tert-butyl (2R,3R)-3-(4-nitrophenyl)aziridine-2-carboxylate (CAS 1431364-32-7) is a chemical compound with the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. IUPAC name: tert-butyl (2R,3R)-3-(4-nitrophenyl)aziridine-2-carboxylate. InChIKey: JXJGFVMVUVDWNV-GHMZBOCLSA-N.
| Molecular formula | C13H16N2O4 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | tert-butyl (2R,3R)-3-(4-nitrophenyl)aziridine-2-carboxylate |
| InChIKey | JXJGFVMVUVDWNV-GHMZBOCLSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H]1[C@H](N1)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)