CAS 1431470-10-8 is the registry number for Methyl 4-azidopyridine-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 4-azidopyridine-2-carboxylate (CAS 1431470-10-8) is a chemical compound with the molecular formula C7H6N4O2 and a molecular weight of 178.15 g/mol. IUPAC name: methyl 4-azidopyridine-2-carboxylate. InChIKey: ZFLNHISOGSWDDI-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O2 |
|---|---|
| Molecular weight | 178.15 g/mol |
| IUPAC name | methyl 4-azidopyridine-2-carboxylate |
| InChIKey | ZFLNHISOGSWDDI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC=CC(=C1)N=[N+]=[N-] |
Computed by PubChem (NCBI)