Products 1431533-17-3
CAS 1431533-17-3 is the registry number for 4-(cyclopropylmethoxy)-2,3-difluorobenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(cyclopropylmethoxy)-2,3-difluorobenzoic acid (CAS 1431533-17-3) is a chemical compound with the molecular formula C11H10F2O3 and a molecular weight of 228.19 g/mol. IUPAC name: 4-(cyclopropylmethoxy)-2,3-difluorobenzoic acid. InChIKey: HKPFQPZASRSLJP-UHFFFAOYSA-N.
| Molecular formula | C11H10F2O3 |
|---|---|
| Molecular weight | 228.19 g/mol |
| IUPAC name | 4-(cyclopropylmethoxy)-2,3-difluorobenzoic acid |
| InChIKey | HKPFQPZASRSLJP-UHFFFAOYSA-N |
| SMILES | C1CC1COC2=C(C(=C(C=C2)C(=O)O)F)F |
Computed by PubChem (NCBI)