Products 1432065-00-3
CAS 1432065-00-3 appears in our catalog under these names: 6-Hydroxy Chlorzoxazone-d2, >95% (HPLC), 6-Hydroxy Chlorzoxazone-d2. Offered by: TRC, MedChemExpress. Available pack sizes: 0,5mg, 1mg, 5mg, 5 mg, 1 mg, 500 μg.
5-chloro-4,7-dideuterio-6-hydroxy-3H-1,3-benzoxazol-2-one (CAS 1432065-00-3) is a chemical compound with the molecular formula C7H4ClNO3 and a molecular weight of 187.57 g/mol. IUPAC name: 5-chloro-4,7-dideuterio-6-hydroxy-3H-1,3-benzoxazol-2-one. InChIKey: AGLXDWOTVQZHIQ-QDNHWIQGSA-N.
| Molecular formula | C7H4ClNO3 |
|---|---|
| Molecular weight | 187.57 g/mol |
| IUPAC name | 5-chloro-4,7-dideuterio-6-hydroxy-3H-1,3-benzoxazol-2-one |
| InChIKey | AGLXDWOTVQZHIQ-QDNHWIQGSA-N |
| SMILES | [2H]C1=C2C(=C(C(=C1Cl)O)[2H])OC(=O)N2 |
Computed by PubChem (NCBI)