Products 475295-90-0
CAS 475295-90-0 is the registry number for 6-Hydroxy Chlorzoxazone-13C6. Offered by: TRC, MedChemExpress. Available pack sizes: 0,25mg, 2,5mg, 5 mg.
5-chloro-6-hydroxy-3H-1,3-benzoxazol-2-one (CAS 475295-90-0) is a chemical compound with the molecular formula C7H4ClNO3 and a molecular weight of 191.52 g/mol. IUPAC name: 5-chloro-6-hydroxy-3H-1,3-benzoxazol-2-one. InChIKey: AGLXDWOTVQZHIQ-IDEBNGHGSA-N.
| Molecular formula | C7H4ClNO3 |
|---|---|
| Molecular weight | 191.52 g/mol |
| IUPAC name | 5-chloro-6-hydroxy-3H-1,3-benzoxazol-2-one |
| InChIKey | AGLXDWOTVQZHIQ-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13C]2[13C](=[13CH][13C](=[13C]1Cl)O)OC(=O)N2 |
Computed by PubChem (NCBI)