Products 1784060-40-7
CAS 1784060-40-7 appears in our catalog under these names: 6-Hydroxy Chlorzoxazone-D₂-¹⁵N, 6–Hydroxy Chlorzoxazone–15N,d2, 6-Hydroxy Chlorzoxazone-15N,d2, 96.54%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 100mg, 1mg, 1 mg.
5-chloro-4,7-dideuterio-6-hydroxy-3H-1,3-benzoxazol-2-one (CAS 1784060-40-7) is a chemical compound with the molecular formula C7H4ClNO3 and a molecular weight of 188.57 g/mol. IUPAC name: 5-chloro-4,7-dideuterio-6-hydroxy-3H-1,3-benzoxazol-2-one. InChIKey: AGLXDWOTVQZHIQ-MRQHIAEYSA-N.
| Molecular formula | C7H4ClNO3 |
|---|---|
| Molecular weight | 188.57 g/mol |
| IUPAC name | 5-chloro-4,7-dideuterio-6-hydroxy-3H-1,3-benzoxazol-2-one |
| InChIKey | AGLXDWOTVQZHIQ-MRQHIAEYSA-N |
| SMILES | [2H]C1=C2C(=C(C(=C1Cl)O)[2H])OC(=O)[15NH]2 |
Computed by PubChem (NCBI)