Products 1432477-07-0
CAS 1432477-07-0 appears in our catalog under these names: Methyl 7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-9-carboxylate, 97%, 97%, Methyl 7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-9-carboxylate, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 25mg, 50mg, 250mg.
Methyl 6-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate (CAS 1432477-07-0) is a chemical compound with the molecular formula C13H12ClNO2 and a molecular weight of 249.69 g/mol. IUPAC name: methyl 6-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate. InChIKey: DYGAFNTWMUVEES-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO2 |
|---|---|
| Molecular weight | 249.69 g/mol |
| IUPAC name | methyl 6-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate |
| InChIKey | DYGAFNTWMUVEES-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2CCCN2C3=C1C=C(C=C3)Cl |
Computed by PubChem (NCBI)