CAS 1432679-22-5 appears in our catalog under these names: (4-Chloro-2-cyanophenyl)methyl acetate, 95%, (4-Chloro-2-cyanophenyl)methyl acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
(4-chloro-2-cyanophenyl)methyl acetate (CAS 1432679-22-5) is a chemical compound with the molecular formula C10H8ClNO2 and a molecular weight of 209.63 g/mol. IUPAC name: (4-chloro-2-cyanophenyl)methyl acetate. InChIKey: KARHIRHASQFDHI-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2 |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | (4-chloro-2-cyanophenyl)methyl acetate |
| InChIKey | KARHIRHASQFDHI-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC1=C(C=C(C=C1)Cl)C#N |
Computed by PubChem (NCBI)