Products 1432681-83-8
CAS 1432681-83-8 appears in our catalog under these names: 1-Bromo-1,1-difluoro-3-phenylpropan-2-one, 95%, 1-Bromo-1,1-difluoro-3-phenylpropan-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-bromo-1,1-difluoro-3-phenylpropan-2-one (CAS 1432681-83-8) is a chemical compound with the molecular formula C9H7BrF2O and a molecular weight of 249.05 g/mol. IUPAC name: 1-bromo-1,1-difluoro-3-phenylpropan-2-one. InChIKey: NPXQURIDBHHQMW-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O |
|---|---|
| Molecular weight | 249.05 g/mol |
| IUPAC name | 1-bromo-1,1-difluoro-3-phenylpropan-2-one |
| InChIKey | NPXQURIDBHHQMW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(=O)C(F)(F)Br |
Computed by PubChem (NCBI)